import torch import torch.nn as nn import torch.nn.functional as F from mol_tree import Vocab, MolTree, MolTreeNode from nnutils import create_var, GRU from chemutils import enum_assemble, set_atommap import copy MAX_NB = 15 MAX_DECODE_LEN = 100 class JTNNDecoder(nn.Module): def __init__(self, vocab, hidden_size, latent_size, embedding): super(JTNNDecoder, self).__init__() self.hidden_size = hidden_size self.vocab_size = vocab.size() self.vocab = vocab self.embedding = embedding #GRU Weights self.W_z = nn.Linear(2 * hidden_size, hidden_size) self.U_r = nn.Linear(hidden_size, hidden_size, bias=False) self.W_r = nn.Linear(hidden_size, hidden_size) self.W_h = nn.Linear(2 * hidden_size, hidden_size) #Word Prediction Weights self.W = nn.Linear(hidden_size + latent_size, hidden_size) #Stop Prediction Weights self.U = nn.Linear(hidden_size + latent_size, hidden_size) self.U_i = nn.Linear(2 * hidden_size, hidden_size) #Output Weights self.W_o = nn.Linear(hidden_size, self.vocab_size) self.U_o = nn.Linear(hidden_size, 1) #Loss Functions self.pred_loss = nn.CrossEntropyLoss(size_average=False) self.stop_loss = nn.BCEWithLogitsLoss(size_average=False) def aggregate(self, hiddens, contexts, x_tree_vecs, mode): if mode == 'word': V, V_o = self.W, self.W_o elif mode == 'stop': V, V_o = self.U, self.U_o else: raise ValueError('aggregate mode is wrong') tree_contexts = x_tree_vecs.index_select(0, contexts) input_vec = torch.cat([hiddens, tree_contexts], dim=-1) output_vec = F.relu( V(input_vec) ) return V_o(output_vec) def forward(self, mol_batch, x_tree_vecs): pred_hiddens,pred_contexts,pred_targets = [],[],[] stop_hiddens,stop_contexts,stop_targets = [],[],[] traces = [] for mol_tree in mol_batch: s = [] dfs(s, mol_tree.nodes[0], -1) traces.append(s) for node in mol_tree.nodes: node.neighbors = [] #Predict Root batch_size = len(mol_batch) pred_hiddens.append(create_var(torch.zeros(len(mol_batch),self.hidden_size))) pred_targets.extend([mol_tree.nodes[0].wid for mol_tree in mol_batch]) pred_contexts.append( create_var( torch.LongTensor(range(batch_size)) ) ) max_iter = max([len(tr) for tr in traces]) padding = create_var(torch.zeros(self.hidden_size), False) h = {} for t in xrange(max_iter): prop_list = [] batch_list = [] for i,plist in enumerate(traces): if t < len(plist): prop_list.append(plist[t]) batch_list.append(i) cur_x = [] cur_h_nei,cur_o_nei = [],[] for node_x, real_y, _ in prop_list: #Neighbors for message passing (target not included) cur_nei = [h[(node_y.idx,node_x.idx)] for node_y in node_x.neighbors if node_y.idx != real_y.idx] pad_len = MAX_NB - len(cur_nei) cur_h_nei.extend(cur_nei) cur_h_nei.extend([padding] * pad_len) #Neighbors for stop prediction (all neighbors) cur_nei = [h[(node_y.idx,node_x.idx)] for node_y in node_x.neighbors] pad_len = MAX_NB - len(cur_nei) cur_o_nei.extend(cur_nei) cur_o_nei.extend([padding] * pad_len) #Current clique embedding cur_x.append(node_x.wid) #Clique embedding cur_x = create_var(torch.LongTensor(cur_x)) cur_x = self.embedding(cur_x) #Message passing cur_h_nei = torch.stack(cur_h_nei, dim=0).view(-1,MAX_NB,self.hidden_size) new_h = GRU(cur_x, cur_h_nei, self.W_z, self.W_r, self.U_r, self.W_h) #Node Aggregate cur_o_nei = torch.stack(cur_o_nei, dim=0).view(-1,MAX_NB,self.hidden_size) cur_o = cur_o_nei.sum(dim=1) #Gather targets pred_target,pred_list = [],[] stop_target = [] for i,m in enumerate(prop_list): node_x,node_y,direction = m x,y = node_x.idx,node_y.idx h[(x,y)] = new_h[i] node_y.neighbors.append(node_x) if direction == 1: pred_target.append(node_y.wid) pred_list.append(i) stop_target.append(direction) #Hidden states for stop prediction cur_batch = create_var(torch.LongTensor(batch_list)) stop_hidden = torch.cat([cur_x,cur_o], dim=1) stop_hiddens.append( stop_hidden ) stop_contexts.append( cur_batch ) stop_targets.extend( stop_target ) #Hidden states for clique prediction if len(pred_list) > 0: batch_list = [batch_list[i] for i in pred_list] cur_batch = create_var(torch.LongTensor(batch_list)) pred_contexts.append( cur_batch ) cur_pred = create_var(torch.LongTensor(pred_list)) pred_hiddens.append( new_h.index_select(0, cur_pred) ) pred_targets.extend( pred_target ) #Last stop at root cur_x,cur_o_nei = [],[] for mol_tree in mol_batch: node_x = mol_tree.nodes[0] cur_x.append(node_x.wid) cur_nei = [h[(node_y.idx,node_x.idx)] for node_y in node_x.neighbors] pad_len = MAX_NB - len(cur_nei) cur_o_nei.extend(cur_nei) cur_o_nei.extend([padding] * pad_len) cur_x = create_var(torch.LongTensor(cur_x)) cur_x = self.embedding(cur_x) cur_o_nei = torch.stack(cur_o_nei, dim=0).view(-1,MAX_NB,self.hidden_size) cur_o = cur_o_nei.sum(dim=1) stop_hidden = torch.cat([cur_x,cur_o], dim=1) stop_hiddens.append( stop_hidden ) stop_contexts.append( create_var( torch.LongTensor(range(batch_size)) ) ) stop_targets.extend( [0] * len(mol_batch) ) #Predict next clique pred_contexts = torch.cat(pred_contexts, dim=0) pred_hiddens = torch.cat(pred_hiddens, dim=0) pred_scores = self.aggregate(pred_hiddens, pred_contexts, x_tree_vecs, 'word') pred_targets = create_var(torch.LongTensor(pred_targets)) pred_loss = self.pred_loss(pred_scores, pred_targets) / len(mol_batch) _,preds = torch.max(pred_scores, dim=1) pred_acc = torch.eq(preds, pred_targets).float() pred_acc = torch.sum(pred_acc) / pred_targets.nelement() #Predict stop stop_contexts = torch.cat(stop_contexts, dim=0) stop_hiddens = torch.cat(stop_hiddens, dim=0) stop_hiddens = F.relu( self.U_i(stop_hiddens) ) stop_scores = self.aggregate(stop_hiddens, stop_contexts, x_tree_vecs, 'stop') stop_scores = stop_scores.squeeze(-1) stop_targets = create_var(torch.Tensor(stop_targets)) stop_loss = self.stop_loss(stop_scores, stop_targets) / len(mol_batch) stops = torch.ge(stop_scores, 0).float() stop_acc = torch.eq(stops, stop_targets).float() stop_acc = torch.sum(stop_acc) / stop_targets.nelement() return pred_loss, stop_loss, pred_acc.item(), stop_acc.item() def decode(self, x_tree_vecs, prob_decode): assert x_tree_vecs.size(0) == 1 stack = [] init_hiddens = create_var( torch.zeros(1, self.hidden_size) ) zero_pad = create_var(torch.zeros(1,1,self.hidden_size)) contexts = create_var( torch.LongTensor(1).zero_() ) #Root Prediction root_score = self.aggregate(init_hiddens, contexts, x_tree_vecs, 'word') _,root_wid = torch.max(root_score, dim=1) root_wid = root_wid.item() root = MolTreeNode(self.vocab.get_smiles(root_wid)) root.wid = root_wid root.idx = 0 stack.append( (root, self.vocab.get_slots(root.wid)) ) all_nodes = [root] h = {} for step in xrange(MAX_DECODE_LEN): node_x,fa_slot = stack[-1] cur_h_nei = [ h[(node_y.idx,node_x.idx)] for node_y in node_x.neighbors ] if len(cur_h_nei) > 0: cur_h_nei = torch.stack(cur_h_nei, dim=0).view(1,-1,self.hidden_size) else: cur_h_nei = zero_pad cur_x = create_var(torch.LongTensor([node_x.wid])) cur_x = self.embedding(cur_x) #Predict stop cur_h = cur_h_nei.sum(dim=1) stop_hiddens = torch.cat([cur_x,cur_h], dim=1) stop_hiddens = F.relu( self.U_i(stop_hiddens) ) stop_score = self.aggregate(stop_hiddens, contexts, x_tree_vecs, 'stop') if prob_decode: backtrack = (torch.bernoulli( torch.sigmoid(stop_score) ).item() == 0) else: backtrack = (stop_score.item() < 0) if not backtrack: #Forward: Predict next clique new_h = GRU(cur_x, cur_h_nei, self.W_z, self.W_r, self.U_r, self.W_h) pred_score = self.aggregate(new_h, contexts, x_tree_vecs, 'word') if prob_decode: sort_wid = torch.multinomial(F.softmax(pred_score, dim=1).squeeze(), 5) else: _,sort_wid = torch.sort(pred_score, dim=1, descending=True) sort_wid = sort_wid.data.squeeze() next_wid = None for wid in sort_wid[:5]: slots = self.vocab.get_slots(wid) node_y = MolTreeNode(self.vocab.get_smiles(wid)) if have_slots(fa_slot, slots) and can_assemble(node_x, node_y): next_wid = wid next_slots = slots break if next_wid is None: backtrack = True #No more children can be added else: node_y = MolTreeNode(self.vocab.get_smiles(next_wid)) node_y.wid = next_wid node_y.idx = len(all_nodes) node_y.neighbors.append(node_x) h[(node_x.idx,node_y.idx)] = new_h[0] stack.append( (node_y,next_slots) ) all_nodes.append(node_y) if backtrack: #Backtrack, use if instead of else if len(stack) == 1: break #At root, terminate node_fa,_ = stack[-2] cur_h_nei = [ h[(node_y.idx,node_x.idx)] for node_y in node_x.neighbors if node_y.idx != node_fa.idx ] if len(cur_h_nei) > 0: cur_h_nei = torch.stack(cur_h_nei, dim=0).view(1,-1,self.hidden_size) else: cur_h_nei = zero_pad new_h = GRU(cur_x, cur_h_nei, self.W_z, self.W_r, self.U_r, self.W_h) h[(node_x.idx,node_fa.idx)] = new_h[0] node_fa.neighbors.append(node_x) stack.pop() return root, all_nodes """ Helper Functions: """ def dfs(stack, x, fa_idx): for y in x.neighbors: if y.idx == fa_idx: continue stack.append( (x,y,1) ) dfs(stack, y, x.idx) stack.append( (y,x,0) ) def have_slots(fa_slots, ch_slots): if len(fa_slots) > 2 and len(ch_slots) > 2: return True matches = [] for i,s1 in enumerate(fa_slots): a1,c1,h1 = s1 for j,s2 in enumerate(ch_slots): a2,c2,h2 = s2 if a1 == a2 and c1 == c2 and (a1 != "C" or h1 + h2 >= 4): matches.append( (i,j) ) if len(matches) == 0: return False fa_match,ch_match = zip(*matches) if len(set(fa_match)) == 1 and 1 < len(fa_slots) <= 2: #never remove atom from ring fa_slots.pop(fa_match[0]) if len(set(ch_match)) == 1 and 1 < len(ch_slots) <= 2: #never remove atom from ring ch_slots.pop(ch_match[0]) return True def can_assemble(node_x, node_y): node_x.nid = 1 node_x.is_leaf = False set_atommap(node_x.mol, node_x.nid) neis = node_x.neighbors + [node_y] for i,nei in enumerate(neis): nei.nid = i + 2 nei.is_leaf = (len(nei.neighbors) <= 1) if nei.is_leaf: set_atommap(nei.mol, 0) else: set_atommap(nei.mol, nei.nid) neighbors = [nei for nei in neis if nei.mol.GetNumAtoms() > 1] neighbors = sorted(neighbors, key=lambda x:x.mol.GetNumAtoms(), reverse=True) singletons = [nei for nei in neis if nei.mol.GetNumAtoms() == 1] neighbors = singletons + neighbors cands,aroma_scores = enum_assemble(node_x, neighbors) return len(cands) > 0# and sum(aroma_scores) >= 0 if __name__ == "__main__": smiles = ["O=C1[C@@H]2C=C[C@@H](C=CC2)C1(c1ccccc1)c1ccccc1","O=C([O-])CC[C@@]12CCCC[C@]1(O)OC(=O)CC2", "ON=C1C[C@H]2CC3(C[C@@H](C1)c1ccccc12)OCCO3", "C[C@H]1CC(=O)[C@H]2[C@@]3(O)C(=O)c4cccc(O)c4[C@@H]4O[C@@]43[C@@H](O)C[C@]2(O)C1", 'Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br', 'CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1', "O=c1c2ccc3c(=O)n(-c4nccs4)c(=O)c4ccc(c(=O)n1-c1nccs1)c2c34", "O=C(N1CCc2c(F)ccc(F)c2C1)C1(O)Cc2ccccc2C1"] for s in smiles: print s tree = MolTree(s) for i,node in enumerate(tree.nodes): node.idx = i stack = [] dfs(stack, tree.nodes[0], -1) for x,y,d in stack: print x.smiles, y.smiles, d print '------------------------------'